About (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide
(E)-N-(2-methylpropyl)non-2-en-6,8-diynamide (PubChem CID 101414630) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide.
Molecular Properties
| Compound Name | (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide |
| PubChem CID | 101414630 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide |
| SMILES | C#CC#CCC/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C13H17NO/c1-4-5-6-7-8-9-10-13(15)14-11-12(2)3/h1,9-10,12H,7-8,11H2,2-3H3,(H,14,15)/b10-9+ |
| InChIKey | RITIPEBSFZSULI-MDZDMXLPSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide?
The IUPAC name of (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide (CID 101414630) is (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide.
What is the SMILES notation for (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide?
The canonical SMILES for (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide is C#CC#CCC/C=C/C(=O)NCC(C)C.
What is the InChIKey of (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide?
The InChIKey is RITIPEBSFZSULI-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H17NO/c1-4-5-6-7-8-9-10-13(15)14-11-12(2)3/h1,9-10,12H,7-8,11H2,2-3H3,(H,14,15)/b10-9+.
What are the key properties of (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide?
(E)-N-(2-methylpropyl)non-2-en-6,8-diynamide has a molecular weight of 203.28 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2-methylpropyl)non-2-en-6,8-diynamide is sourced from PubChem (CID 101414630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).