About 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one
3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one (PubChem CID 101414654) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one |
| PubChem CID | 101414654 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one |
| SMILES | C/C=C/C=C/CC1=C(/C=C/C)C(=O)OC1 |
| InChI | InChI=1S/C13H16O2/c1-3-5-6-7-9-11-10-15-13(14)12(11)8-4-2/h3-8H,9-10H2,1-2H3/b5-3+,7-6+,8-4+ |
| InChIKey | RGFKQPHWBMCPEB-CCPOWDLISA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one?
The IUPAC name of 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one (CID 101414654) is 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one.
What is the SMILES notation for 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one?
The canonical SMILES for 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one is C/C=C/C=C/CC1=C(/C=C/C)C(=O)OC1.
What is the InChIKey of 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one?
The InChIKey is RGFKQPHWBMCPEB-CCPOWDLISA-N. The full InChI is InChI=1S/C13H16O2/c1-3-5-6-7-9-11-10-15-13(14)12(11)8-4-2/h3-8H,9-10H2,1-2H3/b5-3+,7-6+,8-4+.
What are the key properties of 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one?
3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one has a molecular weight of 204.27 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E,4E)-hexa-2,4-dienyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one is sourced from PubChem (CID 101414654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).