C28H42O3S2Si — CID 101414683
(3R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)-6-methylheptane-3,5-diol (PubChem CID 101414683) has the molecular formula C28H42O3S2Si and a molecular weight of 518.86 g/mol. Its IUPAC name is (3R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)-6-methylheptane-3,5-diol.
| Compound Name | (3R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)-6-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 101414683 |
| Molecular Formula | C28H42O3S2Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (3R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)-6-methylheptane-3,5-diol |
| SMILES | CC(C)(C1SCCCS1)[C@@H](O)C[C@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O3S2Si/c1-27(2,3)34(23-13-8-6-9-14-23,24-15-10-7-11-16-24)31-18-17-22(29)21-25(30)28(4,5)26-32-19-12-20-33-26/h6-11,13-16,22,25-26,29-30H,12,17-21H2,1-5H3/t22-,25+/m1/s1 |
| InChIKey | WVJWGAHTZZXXII-RDGATRHJSA-N |
| XLogP | 5.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|