About 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate
2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate (PubChem CID 101414738) has the molecular formula C21H24N4O6
and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate |
| PubChem CID | 101414738 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCCN(CCOC(=O)c1ccc[nH]1)CCOC(=O)c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C21H24N4O6/c26-19(16-4-1-7-22-16)29-13-10-25(11-14-30-20(27)17-5-2-8-23-17)12-15-31-21(28)18-6-3-9-24-18/h1-9,22-24H,10-15H2 |
| InChIKey | KRAZZHJDPPDZAF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate?
The IUPAC name of 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate (CID 101414738) is 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate?
The canonical SMILES for 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate is O=C(OCCN(CCOC(=O)c1ccc[nH]1)CCOC(=O)c1ccc[nH]1)c1ccc[nH]1.
What is the InChIKey of 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate?
The InChIKey is KRAZZHJDPPDZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O6/c26-19(16-4-1-7-22-16)29-13-10-25(11-14-30-20(27)17-5-2-8-23-17)12-15-31-21(28)18-6-3-9-24-18/h1-9,22-24H,10-15H2.
What are the key properties of 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate?
2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate has a molecular weight of 428.45 g/mol, XLogP of 1.84, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-(1H-pyrrole-2-carbonyloxy)ethyl]amino]ethyl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 101414738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).