C23H37N5O7 — CID 10141494
tert-butyl N-[1-[5-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-2-oxoimidazolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10141494) has the molecular formula C23H37N5O7 and a molecular weight of 495.58 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-2-oxoimidazolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-2-oxoimidazolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10141494 |
| Molecular Formula | C23H37N5O7 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | tert-butyl N-[1-[5-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-2-oxoimidazolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CNC(=O)N1C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H37N5O7/c1-8-10-14(17(29)19(31)24-11-9-2)26-18(30)15-12-25-21(33)28(15)20(32)16(13(3)4)27-22(34)35-23(5,6)7/h9,13-16H,2,8,10-12H2,1,3-7H3,(H,24,31)(H,25,33)(H,26,30)(H,27,34) |
| InChIKey | KNVZFEGSEYTNSF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|