C11H10O2S — CID 101415107
6-(4-methylsulfanylpenta-1,2,3-trienyl)pyran-2-one (PubChem CID 101415107) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 6-(4-methylsulfanylpenta-1,2,3-trienyl)pyran-2-one.
| Compound Name | 6-(4-methylsulfanylpenta-1,2,3-trienyl)pyran-2-one |
|---|---|
| PubChem CID | 101415107 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 6-(4-methylsulfanylpenta-1,2,3-trienyl)pyran-2-one |
| SMILES | CSC(C)=C=C=Cc1cccc(=O)o1 |
| InChI | InChI=1S/C11H10O2S/c1-9(14-2)5-3-6-10-7-4-8-11(12)13-10/h4,6-8H,1-2H3/b9-6+ |
| InChIKey | UHKQQAVHSXDUBK-RMKNXTFCSA-N |
| XLogP | 2.67 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |