C39H34F6 — CID 101415280
2-[2-(9,9-diethylfluoren-2-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-9,9-diethylfluorene (PubChem CID 101415280) has the molecular formula C39H34F6 and a molecular weight of 616.69 g/mol. Its IUPAC name is 2-[2-(9,9-diethylfluoren-2-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-9,9-diethylfluorene.
| Compound Name | 2-[2-(9,9-diethylfluoren-2-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-9,9-diethylfluorene |
|---|---|
| PubChem CID | 101415280 |
| Molecular Formula | C39H34F6 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 2-[2-(9,9-diethylfluoren-2-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(C3=C(c4ccc5c(c4)C(CC)(CC)c4ccccc4-5)C(F)(F)C(F)(F)C3(F)F)cc21 |
| InChI | InChI=1S/C39H34F6/c1-5-35(6-2)29-15-11-9-13-25(29)27-19-17-23(21-31(27)35)33-34(38(42,43)39(44,45)37(33,40)41)24-18-20-28-26-14-10-12-16-30(26)36(7-3,8-4)32(28)22-24/h9-22H,5-8H2,1-4H3 |
| InChIKey | AKEJPIWBLKXBDV-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|