C23H22O7S — CID 101415366
(1S,9S,10R,11S,14R)-11-ethoxy-1-methoxy-14-(4-methylphenyl)sulfinyl-12,15-dioxatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6-triene-8,13-dione (PubChem CID 101415366) has the molecular formula C23H22O7S and a molecular weight of 442.49 g/mol. Its IUPAC name is (1S,9S,10R,11S,14R)-11-ethoxy-1-methoxy-14-(4-methylphenyl)sulfinyl-12,15-dioxatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6-triene-8,13-dione.
| Compound Name | (1S,9S,10R,11S,14R)-11-ethoxy-1-methoxy-14-(4-methylphenyl)sulfinyl-12,15-dioxatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6-triene-8,13-dione |
|---|---|
| PubChem CID | 101415366 |
| Molecular Formula | C23H22O7S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (1S,9S,10R,11S,14R)-11-ethoxy-1-methoxy-14-(4-methylphenyl)sulfinyl-12,15-dioxatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6-triene-8,13-dione |
| SMILES | CCO[C@H]1OC(=O)[C@@]2(S(=O)c3ccc(C)cc3)[C@@H]1[C@@H]1O[C@@]2(OC)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22O7S/c1-4-28-20-17-19-18(24)15-7-5-6-8-16(15)23(27-3,30-19)22(17,21(25)29-20)31(26)14-11-9-13(2)10-12-14/h5-12,17,19-20H,4H2,1-3H3/t17-,19+,20+,22+,23+,31?/m1/s1 |
| InChIKey | DXUBPWXRAQUQSC-DNHFKPPNSA-N |
| XLogP | 2.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |