About methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate
methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate (PubChem CID 101415512) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate |
| PubChem CID | 101415512 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate |
| SMILES | [C-]#[N+]C1=CC(O)C(O)(/C=C/C(=O)OC)C1 |
| InChI | InChI=1S/C10H11NO4/c1-11-7-5-8(12)10(14,6-7)4-3-9(13)15-2/h3-5,8,12,14H,6H2,2H3/b4-3+ |
| InChIKey | PUPIOROGIFQTCN-ONEGZZNKSA-N |
| XLogP | 0.01 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate (CID 101415512) is methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate is [C-]#[N+]C1=CC(O)C(O)(/C=C/C(=O)OC)C1.
What is the InChIKey of methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate?
The InChIKey is PUPIOROGIFQTCN-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H11NO4/c1-11-7-5-8(12)10(14,6-7)4-3-9(13)15-2/h3-5,8,12,14H,6H2,2H3/b4-3+.
What are the key properties of methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate?
methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate has a molecular weight of 209.20 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(1,2-dihydroxy-4-isocyanocyclopent-3-en-1-yl)prop-2-enoate is sourced from PubChem (CID 101415512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).