C31H52O6Si — CID 101415625
methyl (2S,5S,6S,7R,8R,9R,11S,13R,14R,15S)-15-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-2,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate (PubChem CID 101415625) has the molecular formula C31H52O6Si and a molecular weight of 548.84 g/mol. Its IUPAC name is methyl (2S,5S,6S,7R,8R,9R,11S,13R,14R,15S)-15-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-2,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate.
| Compound Name | methyl (2S,5S,6S,7R,8R,9R,11S,13R,14R,15S)-15-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-2,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
|---|---|
| PubChem CID | 101415625 |
| Molecular Formula | C31H52O6Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | methyl (2S,5S,6S,7R,8R,9R,11S,13R,14R,15S)-15-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-2,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
| SMILES | CCO[C@@H]1C[C@H]2C3=C(C[C@H](C(C)=O)[C@@H]2C)[C@@]2(C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]2[C@@H](C(=O)OC)[C@H]3O1 |
| InChI | InChI=1S/C31H52O6Si/c1-12-35-24-16-21-17(2)20(19(4)32)15-22-25(21)28(36-24)26(29(33)34-9)27-18(3)23(13-14-31(22,27)8)37-38(10,11)30(5,6)7/h17-18,20-21,23-24,26-28H,12-16H2,1-11H3/t17-,18+,20-,21+,23-,24-,26+,27+,28-,31+/m0/s1 |
| InChIKey | YFGCUIIPQQNDFV-MLKUHTSKSA-N |
| XLogP | 6.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|