C13H19N — CID 101415671
(3R,8R)-6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-2,3,5,8-tetrahydro-1H-pyrrolizine (PubChem CID 101415671) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3R,8R)-6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-2,3,5,8-tetrahydro-1H-pyrrolizine.
| Compound Name | (3R,8R)-6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-2,3,5,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 101415671 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3R,8R)-6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-2,3,5,8-tetrahydro-1H-pyrrolizine |
| SMILES | C/C=C/C=C/[C@H]1CC[C@@H]2C=C(C)CN21 |
| InChI | InChI=1S/C13H19N/c1-3-4-5-6-12-7-8-13-9-11(2)10-14(12)13/h3-6,9,12-13H,7-8,10H2,1-2H3/b4-3+,6-5+/t12-,13+/m0/s1 |
| InChIKey | WZUUJVBLNPADQZ-RQBFQDKGSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|