About 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol
4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol (PubChem CID 101416039) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol |
| PubChem CID | 101416039 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol |
| SMILES | COC1=C(O)C(OC)CC(/C=C/CO)=C1 |
| InChI | InChI=1S/C11H16O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-4,6,10,12-13H,5,7H2,1-2H3/b4-3+ |
| InChIKey | XUFVAWNAYXZFTK-ONEGZZNKSA-N |
| XLogP | 1.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol?
The IUPAC name of 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol (CID 101416039) is 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol?
The canonical SMILES for 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol is COC1=C(O)C(OC)CC(/C=C/CO)=C1.
What is the InChIKey of 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol?
The InChIKey is XUFVAWNAYXZFTK-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H16O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-4,6,10,12-13H,5,7H2,1-2H3/b4-3+.
What are the key properties of 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol?
4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol has a molecular weight of 212.24 g/mol, XLogP of 1.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxycyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 101416039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).