C28H21N3O — CID 101416105
4-(4-phenylmethoxyphenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 101416105) has the molecular formula C28H21N3O and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-(4-phenylmethoxyphenyl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(4-phenylmethoxyphenyl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 101416105 |
| Molecular Formula | C28H21N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(4-phenylmethoxyphenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(COc2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1 |
| InChI | InChI=1S/C28H21N3O/c1-2-8-21(9-3-1)20-32-24-14-12-22(13-15-24)23-18-27(25-10-4-6-16-29-25)31-28(19-23)26-11-5-7-17-30-26/h1-19H,20H2 |
| InChIKey | RCZVJSOBWKWMRI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |