About 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine
2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine (PubChem CID 101416106) has the molecular formula C24H21N3O3
and a molecular weight of 399.45 g/mol. Its IUPAC name is 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine.
Molecular Properties
| Compound Name | 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine |
| PubChem CID | 101416106 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(OC)c(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O3/c1-28-17-14-22(29-2)24(23(15-17)30-3)16-12-20(18-8-4-6-10-25-18)27-21(13-16)19-9-5-7-11-26-19/h4-15H,1-3H3 |
| InChIKey | USQBQFGWKLMAQK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine?
The IUPAC name of 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine (CID 101416106) is 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine.
What is the SMILES notation for 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine?
The canonical SMILES for 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine is COc1cc(OC)c(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c(OC)c1.
What is the InChIKey of 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine?
The InChIKey is USQBQFGWKLMAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O3/c1-28-17-14-22(29-2)24(23(15-17)30-3)16-12-20(18-8-4-6-10-25-18)27-21(13-16)19-9-5-7-11-26-19/h4-15H,1-3H3.
What are the key properties of 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine?
2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine has a molecular weight of 399.45 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dipyridin-2-yl-4-(2,4,6-trimethoxyphenyl)pyridine is sourced from PubChem (CID 101416106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).