About 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one
1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one (PubChem CID 101416110) has the molecular formula C14H18O6
and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one.
Molecular Properties
| Compound Name | 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one |
| PubChem CID | 101416110 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one |
| SMILES | C=CC(=O)C(O)c1c(OC)ccc(OC)c1OCOC |
| InChI | InChI=1S/C14H18O6/c1-5-9(15)13(16)12-10(18-3)6-7-11(19-4)14(12)20-8-17-2/h5-7,13,16H,1,8H2,2-4H3 |
| InChIKey | IQPMWMSYQIDJMS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one?
The IUPAC name of 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one (CID 101416110) is 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one.
What is the SMILES notation for 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one?
The canonical SMILES for 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one is C=CC(=O)C(O)c1c(OC)ccc(OC)c1OCOC.
What is the InChIKey of 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one?
The InChIKey is IQPMWMSYQIDJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O6/c1-5-9(15)13(16)12-10(18-3)6-7-11(19-4)14(12)20-8-17-2/h5-7,13,16H,1,8H2,2-4H3.
What are the key properties of 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one?
1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one has a molecular weight of 282.29 g/mol, XLogP of 1.48, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,6-dimethoxy-2-(methoxymethoxy)phenyl]-1-hydroxybut-3-en-2-one is sourced from PubChem (CID 101416110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).