C14H16O4 — CID 101416404
(5S)-4-hydroxy-3,5-dimethyl-5-[(1E,4E,6E)-3-oxoocta-1,4,6-trienyl]furan-2-one (PubChem CID 101416404) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (5S)-4-hydroxy-3,5-dimethyl-5-[(1E,4E,6E)-3-oxoocta-1,4,6-trienyl]furan-2-one.
| Compound Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(1E,4E,6E)-3-oxoocta-1,4,6-trienyl]furan-2-one |
|---|---|
| PubChem CID | 101416404 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(1E,4E,6E)-3-oxoocta-1,4,6-trienyl]furan-2-one |
| SMILES | C/C=C/C=C/C(=O)/C=C/[C@]1(C)OC(=O)C(C)=C1O |
| InChI | InChI=1S/C14H16O4/c1-4-5-6-7-11(15)8-9-14(3)12(16)10(2)13(17)18-14/h4-9,16H,1-3H3/b5-4+,7-6+,9-8+/t14-/m0/s1 |
| InChIKey | BIXSPTWWHCZACF-QHPFJLLTSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|