C14H22O2 — CID 101416430
1-acetyl-4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one (PubChem CID 101416430) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-acetyl-4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one.
| Compound Name | 1-acetyl-4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 101416430 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-acetyl-4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
| SMILES | CC(=O)C1C(=O)CC(C)C2CCC(C)CC12 |
| InChI | InChI=1S/C14H22O2/c1-8-4-5-11-9(2)7-13(16)14(10(3)15)12(11)6-8/h8-9,11-12,14H,4-7H2,1-3H3 |
| InChIKey | GZAFFDAQSGDZQU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|