C15H18O — CID 101416443
(7E,13E)-pentadeca-7,13-dien-9,11-diyn-4-one (PubChem CID 101416443) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (7E,13E)-pentadeca-7,13-dien-9,11-diyn-4-one.
| Compound Name | (7E,13E)-pentadeca-7,13-dien-9,11-diyn-4-one |
|---|---|
| PubChem CID | 101416443 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (7E,13E)-pentadeca-7,13-dien-9,11-diyn-4-one |
| SMILES | C/C=C/C#CC#C/C=C/CCC(=O)CCC |
| InChI | InChI=1S/C15H18O/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h3,5,10-11H,4,12-14H2,1-2H3/b5-3+,11-10+ |
| InChIKey | ZDZSHEXCQDGPTA-SALZOXGJSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|