C23H25NO3 — CID 101417104
(1S,5S,6S)-4-tert-butyl-1-methyl-6-phenyl-5-[(E)-2-phenylethenyl]-3,7-dioxa-4-azabicyclo[4.1.0]heptan-2-one (PubChem CID 101417104) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1S,5S,6S)-4-tert-butyl-1-methyl-6-phenyl-5-[(E)-2-phenylethenyl]-3,7-dioxa-4-azabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,5S,6S)-4-tert-butyl-1-methyl-6-phenyl-5-[(E)-2-phenylethenyl]-3,7-dioxa-4-azabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 101417104 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1S,5S,6S)-4-tert-butyl-1-methyl-6-phenyl-5-[(E)-2-phenylethenyl]-3,7-dioxa-4-azabicyclo[4.1.0]heptan-2-one |
| SMILES | CC(C)(C)N1OC(=O)[C@@]2(C)O[C@@]2(c2ccccc2)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H25NO3/c1-21(2,3)24-19(16-15-17-11-7-5-8-12-17)23(18-13-9-6-10-14-18)22(4,27-23)20(25)26-24/h5-16,19H,1-4H3/b16-15+/t19-,22+,23-/m0/s1 |
| InChIKey | MEJVQMGJFXZBPF-SKZIAAAQSA-N |
| XLogP | 4.33 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|