C15H21IO5 — CID 101417121
tert-butyl (1S)-1-[(E)-3-ethoxy-2-iodo-3-oxoprop-1-enyl]-2-oxocyclopentane-1-carboxylate (PubChem CID 101417121) has the molecular formula C15H21IO5 and a molecular weight of 408.23 g/mol. Its IUPAC name is tert-butyl (1S)-1-[(E)-3-ethoxy-2-iodo-3-oxoprop-1-enyl]-2-oxocyclopentane-1-carboxylate.
| Compound Name | tert-butyl (1S)-1-[(E)-3-ethoxy-2-iodo-3-oxoprop-1-enyl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101417121 |
| Molecular Formula | C15H21IO5 |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | tert-butyl (1S)-1-[(E)-3-ethoxy-2-iodo-3-oxoprop-1-enyl]-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)/C(I)=C\[C@@]1(C(=O)OC(C)(C)C)CCCC1=O |
| InChI | InChI=1S/C15H21IO5/c1-5-20-12(18)10(16)9-15(8-6-7-11(15)17)13(19)21-14(2,3)4/h9H,5-8H2,1-4H3/b10-9+/t15-/m0/s1 |
| InChIKey | JCPBUACLXMFFBA-FEAKQIBJSA-N |
| XLogP | 2.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|