C10H16O6 — CID 101417171
dimethyl (2R,6S)-5-hydroxyoxepane-2,6-dicarboxylate (PubChem CID 101417171) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is dimethyl (2R,6S)-5-hydroxyoxepane-2,6-dicarboxylate.
| Compound Name | dimethyl (2R,6S)-5-hydroxyoxepane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 101417171 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | dimethyl (2R,6S)-5-hydroxyoxepane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1CO[C@@H](C(=O)OC)CCC1O |
| InChI | InChI=1S/C10H16O6/c1-14-9(12)6-5-16-8(10(13)15-2)4-3-7(6)11/h6-8,11H,3-5H2,1-2H3/t6-,7?,8+/m0/s1 |
| InChIKey | KMBCCQCPSQGWFS-YPVSKDHRSA-N |
| XLogP | -0.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |