About (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol
(S)-1,3,4-oxadiazol-2-yl(phenyl)methanol (PubChem CID 101417639) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol.
Molecular Properties
| Compound Name | (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol |
| PubChem CID | 101417639 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol |
| SMILES | O[C@@H](c1ccccc1)c1nnco1 |
| InChI | InChI=1S/C9H8N2O2/c12-8(9-11-10-6-13-9)7-4-2-1-3-5-7/h1-6,8,12H/t8-/m0/s1 |
| InChIKey | PWWWNWDSCJUSFC-QMMMGPOBSA-N |
| XLogP | 1.15 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol?
The IUPAC name of (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol (CID 101417639) is (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol.
What is the SMILES notation for (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol?
The canonical SMILES for (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol is O[C@@H](c1ccccc1)c1nnco1.
What is the InChIKey of (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol?
The InChIKey is PWWWNWDSCJUSFC-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-8(9-11-10-6-13-9)7-4-2-1-3-5-7/h1-6,8,12H/t8-/m0/s1.
What are the key properties of (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol?
(S)-1,3,4-oxadiazol-2-yl(phenyl)methanol has a molecular weight of 176.17 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-1,3,4-oxadiazol-2-yl(phenyl)methanol is sourced from PubChem (CID 101417639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).