C19H32OSi — CID 101417967
trimethyl-[(2E,11Z)-2,6,10,10-tetramethylcyclododeca-2,6,7,11-tetraen-1-yl]oxysilane (PubChem CID 101417967) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is trimethyl-[(2E,11Z)-2,6,10,10-tetramethylcyclododeca-2,6,7,11-tetraen-1-yl]oxysilane.
| Compound Name | trimethyl-[(2E,11Z)-2,6,10,10-tetramethylcyclododeca-2,6,7,11-tetraen-1-yl]oxysilane |
|---|---|
| PubChem CID | 101417967 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | trimethyl-[(2E,11Z)-2,6,10,10-tetramethylcyclododeca-2,6,7,11-tetraen-1-yl]oxysilane |
| SMILES | CC1=C=CCC(C)(C)/C=C\C(O[Si](C)(C)C)/C(C)=C/CC1 |
| InChI | InChI=1S/C19H32OSi/c1-16-10-8-12-17(2)18(20-21(5,6)7)13-15-19(3,4)14-9-11-16/h9,12-13,15,18H,8,10,14H2,1-7H3/b15-13-,17-12+ |
| InChIKey | RLGRIYHEYYFOBC-WUEPNDDFSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|