About 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile
2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile (PubChem CID 101417988) has the molecular formula C28H22N4
and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile |
| PubChem CID | 101417988 |
| Molecular Formula | C28H22N4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C[C@H]1[C@@H](C#N)CCN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4/c29-19-22(20-30)18-27-23(21-31)16-17-32(27)28(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,18,23,27H,16-17H2/t23-,27+/m1/s1 |
| InChIKey | BIFXKOQMNVDPSW-KCWPFWIISA-N |
| XLogP | 5.17 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile?
The IUPAC name of 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile (CID 101417988) is 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile?
The canonical SMILES for 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile is N#CC(C#N)=C[C@H]1[C@@H](C#N)CCN1C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile?
The InChIKey is BIFXKOQMNVDPSW-KCWPFWIISA-N. The full InChI is InChI=1S/C28H22N4/c29-19-22(20-30)18-27-23(21-31)16-17-32(27)28(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,18,23,27H,16-17H2/t23-,27+/m1/s1.
What are the key properties of 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile?
2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile has a molecular weight of 414.51 g/mol, XLogP of 5.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S,3S)-3-cyano-1-tritylpyrrolidin-2-yl]methylidene]propanedinitrile is sourced from PubChem (CID 101417988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).