About cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate
cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 101418216) has the molecular formula C14H12F3NO6
and a molecular weight of 347.25 g/mol. Its IUPAC name is cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate |
| PubChem CID | 101418216 |
| Molecular Formula | C14H12F3NO6 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3NO6/c1-23-11(19)13(12(20)24-2)9(10(13)18(21)22)7-3-5-8(6-4-7)14(15,16)17/h3-6,9-10H,1-2H3/t9-,10-/m0/s1 |
| InChIKey | ISOPKWZVZXWXHM-UWVGGRQHSA-N |
| XLogP | 1.78 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate?
The IUPAC name of cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate (CID 101418216) is cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate.
What is the SMILES notation for cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate?
The canonical SMILES for cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate?
The InChIKey is ISOPKWZVZXWXHM-UWVGGRQHSA-N. The full InChI is InChI=1S/C14H12F3NO6/c1-23-11(19)13(12(20)24-2)9(10(13)18(21)22)7-3-5-8(6-4-7)14(15,16)17/h3-6,9-10H,1-2H3/t9-,10-/m0/s1.
What are the key properties of cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate?
cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate has a molecular weight of 347.25 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-dimethyl (2S,3R)-2-nitro-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxylate is sourced from PubChem (CID 101418216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).