C17H23BrO5 — CID 101419029
dimethyl 4-acetyl-5-(4-bromopentyl)cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 101419029) has the molecular formula C17H23BrO5 and a molecular weight of 387.27 g/mol. Its IUPAC name is dimethyl 4-acetyl-5-(4-bromopentyl)cyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-acetyl-5-(4-bromopentyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101419029 |
| Molecular Formula | C17H23BrO5 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | dimethyl 4-acetyl-5-(4-bromopentyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(C(C)=O)=C(CCCC(C)Br)C1 |
| InChI | InChI=1S/C17H23BrO5/c1-10(18)6-5-7-12-8-14(16(20)22-3)15(17(21)23-4)9-13(12)11(2)19/h10H,5-9H2,1-4H3 |
| InChIKey | REASVGWEIZGXJS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|