C11H22O2Si — CID 101419060
2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]prop-2-enyl-trimethylsilane (PubChem CID 101419060) has the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 101419060 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(C[Si](C)(C)C)C1O[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C11H22O2Si/c1-8(7-14(4,5)6)11-12-9(2)10(3)13-11/h9-11H,1,7H2,2-6H3/t9-,10-/m1/s1 |
| InChIKey | GXVJNCIYXAEVRG-NXEZZACHSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|