C14H26N2O4 — CID 101419276
methyl (2S,3S)-2,3-dimorpholin-4-ylpentanoate (PubChem CID 101419276) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-dimorpholin-4-ylpentanoate.
| Compound Name | methyl (2S,3S)-2,3-dimorpholin-4-ylpentanoate |
|---|---|
| PubChem CID | 101419276 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | methyl (2S,3S)-2,3-dimorpholin-4-ylpentanoate |
| SMILES | CC[C@@H]([C@@H](C(=O)OC)N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C14H26N2O4/c1-3-12(15-4-8-19-9-5-15)13(14(17)18-2)16-6-10-20-11-7-16/h12-13H,3-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | MPPJISXDMOGDMJ-STQMWFEESA-N |
| XLogP | -0.03 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |