C9H10ClF4I — CID 101419423
(1S,2S,3R,4R)-2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-iodobicyclo[2.2.1]heptane (PubChem CID 101419423) has the molecular formula C9H10ClF4I and a molecular weight of 356.53 g/mol. Its IUPAC name is (1S,2S,3R,4R)-2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-iodobicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3R,4R)-2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-iodobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101419423 |
| Molecular Formula | C9H10ClF4I |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | (1S,2S,3R,4R)-2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-iodobicyclo[2.2.1]heptane |
| SMILES | FC(F)(Cl)C(F)(F)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1I |
| InChI | InChI=1S/C9H10ClF4I/c10-9(13,14)8(11,12)6-4-1-2-5(3-4)7(6)15/h4-7H,1-3H2/t4-,5+,6+,7+/m0/s1 |
| InChIKey | JLUVWZGXZKGTCX-BDVNFPICSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|