C15H12O — CID 101419672
1,5-di(cyclopenta-2,4-dien-1-yl)penta-1,4-diyn-3-ol (PubChem CID 101419672) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,5-di(cyclopenta-2,4-dien-1-yl)penta-1,4-diyn-3-ol.
| Compound Name | 1,5-di(cyclopenta-2,4-dien-1-yl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 101419672 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1,5-di(cyclopenta-2,4-dien-1-yl)penta-1,4-diyn-3-ol |
| SMILES | OC(C#CC1C=CC=C1)C#CC1C=CC=C1 |
| InChI | InChI=1S/C15H12O/c16-15(11-9-13-5-1-2-6-13)12-10-14-7-3-4-8-14/h1-8,13-16H |
| InChIKey | HLPBCVLCUJTBDR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|