C28H36N4O3Si — CID 10141994
1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[3-(4-cyanophenyl)phenoxy]pentan-3-yl]imidazole-4-carboxamide (PubChem CID 10141994) has the molecular formula C28H36N4O3Si and a molecular weight of 504.71 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[3-(4-cyanophenyl)phenoxy]pentan-3-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[3-(4-cyanophenyl)phenoxy]pentan-3-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 10141994 |
| Molecular Formula | C28H36N4O3Si |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[3-(4-cyanophenyl)phenoxy]pentan-3-yl]imidazole-4-carboxamide |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCOc1cccc(-c2ccc(C#N)cc2)c1)n1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C28H36N4O3Si/c1-20(35-36(5,6)28(2,3)4)26(32-18-25(27(30)33)31-19-32)14-15-34-24-9-7-8-23(16-24)22-12-10-21(17-29)11-13-22/h7-13,16,18-20,26H,14-15H2,1-6H3,(H2,30,33)/t20-,26+/m0/s1 |
| InChIKey | LKIOKPKNSYLVFY-RXFWQSSRSA-N |
| XLogP | 5.94 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|