C27H23F17NO2+ — CID 101420061
[(2S)-4-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methoxy]-4-oxo-1-phenylbutan-2-yl]azanium (PubChem CID 101420061) has the molecular formula C27H23F17NO2+ and a molecular weight of 716.45 g/mol. Its IUPAC name is [(2S)-4-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methoxy]-4-oxo-1-phenylbutan-2-yl]azanium.
| Compound Name | [(2S)-4-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methoxy]-4-oxo-1-phenylbutan-2-yl]azanium |
|---|---|
| PubChem CID | 101420061 |
| Molecular Formula | C27H23F17NO2+ |
| Molecular Weight | 716.45 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | [(2S)-4-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methoxy]-4-oxo-1-phenylbutan-2-yl]azanium |
| SMILES | [NH3+][C@H](CC(=O)OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H22F17NO2/c28-20(29,21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44)11-10-15-6-8-17(9-7-15)14-47-19(46)13-18(45)12-16-4-2-1-3-5-16/h1-9,18H,10-14,45H2/p+1/t18-/m0/s1 |
| InChIKey | TWMSDWPDKBLLGP-SFHVURJKSA-O |
| XLogP | 7.92 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.45 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|