About N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine
N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine (PubChem CID 101420411) has the molecular formula C17H27NO3S2
and a molecular weight of 357.54 g/mol. Its IUPAC name is N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine |
| PubChem CID | 101420411 |
| Molecular Formula | C17H27NO3S2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine |
| SMILES | C=CCN(Cc1ccco1)CC1CSCCOCCOCCS1 |
| InChI | InChI=1S/C17H27NO3S2/c1-2-5-18(13-16-4-3-6-21-16)14-17-15-22-11-9-19-7-8-20-10-12-23-17/h2-4,6,17H,1,5,7-15H2 |
| InChIKey | UUCBNVCENXCWNZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine?
The IUPAC name of N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine (CID 101420411) is N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine.
What is the SMILES notation for N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine?
The canonical SMILES for N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine is C=CCN(Cc1ccco1)CC1CSCCOCCOCCS1.
What is the InChIKey of N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine?
The InChIKey is UUCBNVCENXCWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3S2/c1-2-5-18(13-16-4-3-6-21-16)14-17-15-22-11-9-19-7-8-20-10-12-23-17/h2-4,6,17H,1,5,7-15H2.
What are the key properties of N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine?
N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine has a molecular weight of 357.54 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl)-N-(furan-2-ylmethyl)prop-2-en-1-amine is sourced from PubChem (CID 101420411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).