C37H48O4 — CID 101420430
3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(4-methyl-2-prop-1-en-2-ylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 101420430) has the molecular formula C37H48O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is 3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(4-methyl-2-prop-1-en-2-ylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | 3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(4-methyl-2-prop-1-en-2-ylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 101420430 |
| Molecular Formula | C37H48O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | 3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(4-methyl-2-prop-1-en-2-ylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | C=C(C)C(C=C(C)C)CC12CC(CC=C(C)C)C(C)(C)C(CC=C(C)C)(C(=O)C(=C(O)c3ccccc3)C1=O)C2=O |
| InChI | InChI=1S/C37H48O4/c1-23(2)16-17-29-22-36(21-28(26(7)8)20-25(5)6)32(39)30(31(38)27-14-12-11-13-15-27)33(40)37(34(36)41,35(29,9)10)19-18-24(3)4/h11-16,18,20,28-29,38H,7,17,19,21-22H2,1-6,8-10H3 |
| InChIKey | PFMRPZCBMXCPLO-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|