C16H36N2O11Si6 — CID 101420478
3,5-diisocyanato-1,3,5,7,9,11-hexamethyl-9,11-bis[(2-methylpropan-2-yl)oxy]-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane (PubChem CID 101420478) has the molecular formula C16H36N2O11Si6 and a molecular weight of 600.98 g/mol. Its IUPAC name is 3,5-diisocyanato-1,3,5,7,9,11-hexamethyl-9,11-bis[(2-methylpropan-2-yl)oxy]-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane.
| Compound Name | 3,5-diisocyanato-1,3,5,7,9,11-hexamethyl-9,11-bis[(2-methylpropan-2-yl)oxy]-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
|---|---|
| PubChem CID | 101420478 |
| Molecular Formula | C16H36N2O11Si6 |
| Molecular Weight | 600.98 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | 3,5-diisocyanato-1,3,5,7,9,11-hexamethyl-9,11-bis[(2-methylpropan-2-yl)oxy]-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
| SMILES | CC(C)(C)O[Si]1(C)O[Si](C)(OC(C)(C)C)O[Si]2(C)O[Si](C)(N=C=O)O[Si](C)(N=C=O)O[Si](C)(O1)O2 |
| InChI | InChI=1S/C16H36N2O11Si6/c1-15(2,3)21-32(9)26-33(10,22-16(4,5)6)28-35(12)25-31(8,18-14-20)23-30(7,17-13-19)24-34(11,27-32)29-35/h1-12H3 |
| InChIKey | ATAWDWSUVXKBIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 141.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.98 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|