C27H27NO5 — CID 101420657
(2S,4aR,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one (PubChem CID 101420657) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2S,4aR,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one.
| Compound Name | (2S,4aR,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 101420657 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (2S,4aR,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one |
| SMILES | O=C1N[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H27NO5/c29-26-25(31-17-20-12-6-2-7-13-20)24(30-16-19-10-4-1-5-11-19)23-22(28-26)18-32-27(33-23)21-14-8-3-9-15-21/h1-15,22-25,27H,16-18H2,(H,28,29)/t22-,23+,24+,25-,27+/m1/s1 |
| InChIKey | ZPFDUSYLZKUGAJ-VJIOPBFVSA-N |
| XLogP | 3.77 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |