C26H38N2O8 — CID 10142075
[(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl propan-2-yl carbonate (PubChem CID 10142075) has the molecular formula C26H38N2O8 and a molecular weight of 506.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl propan-2-yl carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 10142075 |
| Molecular Formula | C26H38N2O8 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl propan-2-yl carbonate |
| SMILES | CCc1ccc(Cc2c(O[C@@H]3O[C@H](COC(=O)OC(C)C)[C@@H](O)[C@H](O)[C@H]3O)nn(C(C)C)c2C)cc1 |
| InChI | InChI=1S/C26H38N2O8/c1-7-17-8-10-18(11-9-17)12-19-16(6)28(14(2)3)27-24(19)36-25-23(31)22(30)21(29)20(35-25)13-33-26(32)34-15(4)5/h8-11,14-15,20-23,25,29-31H,7,12-13H2,1-6H3/t20-,21-,22+,23-,25+/m1/s1 |
| InChIKey | WNNLYMOLGFEQFJ-ABMICEGHSA-N |
| XLogP | 2.67 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |