C32H35N5O6 — CID 101420786
9H-fluoren-9-ylmethyl N-[(2S)-1-[(isocyanatomethylcarbamoylamino)methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 101420786) has the molecular formula C32H35N5O6 and a molecular weight of 585.66 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[(isocyanatomethylcarbamoylamino)methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[(isocyanatomethylcarbamoylamino)methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101420786 |
| Molecular Formula | C32H35N5O6 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[(isocyanatomethylcarbamoylamino)methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)Oc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)NCNC(=O)NCN=C=O)cc1 |
| InChI | InChI=1S/C32H35N5O6/c1-32(2,3)43-22-14-12-21(13-15-22)16-28(29(39)34-19-36-30(40)35-18-33-20-38)37-31(41)42-17-27-25-10-6-4-8-23(25)24-9-5-7-11-26(24)27/h4-15,27-28H,16-19H2,1-3H3,(H,34,39)(H,37,41)(H2,35,36,40)/t28-/m0/s1 |
| InChIKey | HTUDATFQEQTQRV-NDEPHWFRSA-N |
| XLogP | 3.98 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|