C12H18O4 — CID 101421330
(3aR)-3a-(1,3-dioxolan-2-yl)-1,2,3,4,5,6-hexahydroindene-5,6-diol (PubChem CID 101421330) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3aR)-3a-(1,3-dioxolan-2-yl)-1,2,3,4,5,6-hexahydroindene-5,6-diol.
| Compound Name | (3aR)-3a-(1,3-dioxolan-2-yl)-1,2,3,4,5,6-hexahydroindene-5,6-diol |
|---|---|
| PubChem CID | 101421330 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3aR)-3a-(1,3-dioxolan-2-yl)-1,2,3,4,5,6-hexahydroindene-5,6-diol |
| SMILES | OC1C=C2CCC[C@@]2(C2OCCO2)CC1O |
| InChI | InChI=1S/C12H18O4/c13-9-6-8-2-1-3-12(8,7-10(9)14)11-15-4-5-16-11/h6,9-11,13-14H,1-5,7H2/t9?,10?,12-/m1/s1 |
| InChIKey | GCVGLDOFEFOVRD-RTYFJBAXSA-N |
| XLogP | 0.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|