C24H17BrO12 — CID 101421585
2-bromo-4-(2,4,6-trihydroxyphenyl)-6-[2,4,6-trihydroxy-3-(2,4,6-trihydroxyphenyl)phenyl]benzene-1,3,5-triol (PubChem CID 101421585) has the molecular formula C24H17BrO12 and a molecular weight of 577.29 g/mol. Its IUPAC name is 2-bromo-4-(2,4,6-trihydroxyphenyl)-6-[2,4,6-trihydroxy-3-(2,4,6-trihydroxyphenyl)phenyl]benzene-1,3,5-triol.
| Compound Name | 2-bromo-4-(2,4,6-trihydroxyphenyl)-6-[2,4,6-trihydroxy-3-(2,4,6-trihydroxyphenyl)phenyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 101421585 |
| Molecular Formula | C24H17BrO12 |
| Molecular Weight | 577.29 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | 2-bromo-4-(2,4,6-trihydroxyphenyl)-6-[2,4,6-trihydroxy-3-(2,4,6-trihydroxyphenyl)phenyl]benzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(-c2c(O)cc(O)c(-c3c(O)c(Br)c(O)c(-c4c(O)cc(O)cc4O)c3O)c2O)c(O)c1 |
| InChI | InChI=1S/C24H17BrO12/c25-20-23(36)18(15-10(30)3-7(27)4-11(15)31)22(35)19(24(20)37)17-13(33)5-12(32)16(21(17)34)14-8(28)1-6(26)2-9(14)29/h1-5,26-37H |
| InChIKey | CJWINCMNQKZUII-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |