C22H25NO2 — CID 101422285
12-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol (PubChem CID 101422285) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 12-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol.
| Compound Name | 12-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol |
|---|---|
| PubChem CID | 101422285 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 12-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol |
| SMILES | CC(C)[C@H]1COC(c2cc3ccc2CCc2ccc(cc2O)CC3)=N1 |
| InChI | InChI=1S/C22H25NO2/c1-14(2)20-13-25-22(23-20)19-11-15-3-4-16-6-8-18(21(24)12-16)10-9-17(19)7-5-15/h5-8,11-12,14,20,24H,3-4,9-10,13H2,1-2H3/t20-/m1/s1 |
| InChIKey | FZCKERLCJNWNFW-HXUWFJFHSA-N |
| XLogP | 4.08 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |