C6H7F3O3 — CID 101422665
(2S)-3-methylidene-2-(trifluoromethyl)oxolane-2,4-diol (PubChem CID 101422665) has the molecular formula C6H7F3O3 and a molecular weight of 184.11 g/mol. Its IUPAC name is (2S)-3-methylidene-2-(trifluoromethyl)oxolane-2,4-diol.
| Compound Name | (2S)-3-methylidene-2-(trifluoromethyl)oxolane-2,4-diol |
|---|---|
| PubChem CID | 101422665 |
| Molecular Formula | C6H7F3O3 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (2S)-3-methylidene-2-(trifluoromethyl)oxolane-2,4-diol |
| SMILES | C=C1C(O)CO[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O3/c1-3-4(10)2-12-5(3,11)6(7,8)9/h4,10-11H,1-2H2/t4?,5-/m0/s1 |
| InChIKey | SQFXITQLBMBNNN-AKGZTFGVSA-N |
| XLogP | 0.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|