C27H30O14 — CID 101422757
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one (PubChem CID 101422757) has the molecular formula C27H30O14 and a molecular weight of 578.52 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 101422757 |
| Molecular Formula | C27H30O14 |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one |
| SMILES | C[C@@H]1O[C@@H](c2c(O)c([C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)c3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O14/c1-7-17(31)21(35)23(37)26(39-7)15-19(33)14-12(30)6-13(9-3-4-10(28)11(29)5-9)41-25(14)16(20(15)34)27-24(38)22(36)18(32)8(2)40-27/h3-8,17-18,21-24,26-29,31-38H,1-2H3/t7-,8-,17-,18-,21+,22+,23+,24+,26-,27-/m0/s1 |
| InChIKey | UZQZUGANRMSXPO-PNHGXYHPSA-N |
| XLogP | -0.63 |
| TPSA | 250.97 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|