About (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium
(4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium (PubChem CID 101423418) has the molecular formula C6H7O2+
and a molecular weight of 111.12 g/mol. Its IUPAC name is (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium.
Molecular Properties
| Compound Name | (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium |
| PubChem CID | 101423418 |
| Molecular Formula | C6H7O2+ |
| Molecular Weight | 111.12 g/mol |
| Exact Mass | 111.04 |
| IUPAC Name | (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium |
| SMILES | [H][O+]=C1C=CC(O)C=C1 |
| InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-5,7H/p+1 |
| InChIKey | ZHIJXDCTUKJHPK-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.12 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium?
The IUPAC name of (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium (CID 101423418) is (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium.
What is the SMILES notation for (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium?
The canonical SMILES for (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium is [H][O+]=C1C=CC(O)C=C1.
What is the InChIKey of (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium?
The InChIKey is ZHIJXDCTUKJHPK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-5,7H/p+1.
What are the key properties of (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium?
(4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium has a molecular weight of 111.12 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxycyclohexa-2,5-dien-1-ylidene)oxidanium is sourced from PubChem (CID 101423418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).