C23H41ClO8Si — CID 101424036
(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-5-[(2S,4R,5S,6R)-5-chloro-2-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-3-methyl-2-oxopentyl]oxolan-2-one (PubChem CID 101424036) has the molecular formula C23H41ClO8Si and a molecular weight of 509.11 g/mol. Its IUPAC name is (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-5-[(2S,4R,5S,6R)-5-chloro-2-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-3-methyl-2-oxopentyl]oxolan-2-one.
| Compound Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-5-[(2S,4R,5S,6R)-5-chloro-2-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-3-methyl-2-oxopentyl]oxolan-2-one |
|---|---|
| PubChem CID | 101424036 |
| Molecular Formula | C23H41ClO8Si |
| Molecular Weight | 509.11 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-5-[(2S,4R,5S,6R)-5-chloro-2-hydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-3-methyl-2-oxopentyl]oxolan-2-one |
| SMILES | CO[C@@H]1C[C@](O)(CC[C@H](C)C(=O)C[C@@H]2OC(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1Cl |
| InChI | InChI=1S/C23H41ClO8Si/c1-14(8-9-23(28)12-18(29-5)21(24)19(13-25)31-23)15(26)10-16-17(11-20(27)30-16)32-33(6,7)22(2,3)4/h14,16-19,21,25,28H,8-13H2,1-7H3/t14-,16-,17-,18+,19+,21-,23-/m0/s1 |
| InChIKey | DKAFJWHNBZZQDX-XEJLEEPMSA-N |
| XLogP | 3.16 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|