C9H14N2O2S — CID 101424333
(6S,8aR)-3,3,6-trimethyl-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione (PubChem CID 101424333) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (6S,8aR)-3,3,6-trimethyl-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione.
| Compound Name | (6S,8aR)-3,3,6-trimethyl-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione |
|---|---|
| PubChem CID | 101424333 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (6S,8aR)-3,3,6-trimethyl-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione |
| SMILES | C[C@@H]1NC(=O)[C@@H]2CSC(C)(C)N2C1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-5-8(13)11-6(7(12)10-5)4-14-9(11,2)3/h5-6H,4H2,1-3H3,(H,10,12)/t5-,6-/m0/s1 |
| InChIKey | PDSXRUZIFDBXOC-WDSKDSINSA-N |
| XLogP | 0.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |