C14H20F2O6 — CID 101424467
[(3R,4S,5S,6R)-4-acetyloxy-5-(1,1-difluorobut-3-enyl)-6-methoxyoxan-3-yl] acetate (PubChem CID 101424467) has the molecular formula C14H20F2O6 and a molecular weight of 322.30 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4-acetyloxy-5-(1,1-difluorobut-3-enyl)-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-4-acetyloxy-5-(1,1-difluorobut-3-enyl)-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 101424467 |
| Molecular Formula | C14H20F2O6 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(3R,4S,5S,6R)-4-acetyloxy-5-(1,1-difluorobut-3-enyl)-6-methoxyoxan-3-yl] acetate |
| SMILES | C=CCC(F)(F)[C@@H]1[C@H](OC)OC[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H20F2O6/c1-5-6-14(15,16)11-12(22-9(3)18)10(21-8(2)17)7-20-13(11)19-4/h5,10-13H,1,6-7H2,2-4H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | ZYAAHYVSJJQLBK-YVECIDJPSA-N |
| XLogP | 1.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|