About 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide
3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide (PubChem CID 101424594) has the molecular formula C14H16N4O3
and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide.
Molecular Properties
| Compound Name | 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide |
| PubChem CID | 101424594 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide |
| SMILES | Cc1cc(/N=N/C(C(=O)Nc2ccccc2)C(C)O)no1 |
| InChI | InChI=1S/C14H16N4O3/c1-9-8-12(18-21-9)16-17-13(10(2)19)14(20)15-11-6-4-3-5-7-11/h3-8,10,13,19H,1-2H3,(H,15,20)/b17-16+ |
| InChIKey | PPWFSCIMPHWYNJ-WUKNDPDISA-N |
| XLogP | 2.45 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide?
The IUPAC name of 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide (CID 101424594) is 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide.
What is the SMILES notation for 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide?
The canonical SMILES for 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide is Cc1cc(/N=N/C(C(=O)Nc2ccccc2)C(C)O)no1.
What is the InChIKey of 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide?
The InChIKey is PPWFSCIMPHWYNJ-WUKNDPDISA-N. The full InChI is InChI=1S/C14H16N4O3/c1-9-8-12(18-21-9)16-17-13(10(2)19)14(20)15-11-6-4-3-5-7-11/h3-8,10,13,19H,1-2H3,(H,15,20)/b17-16+.
What are the key properties of 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide?
3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide has a molecular weight of 288.31 g/mol, XLogP of 2.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[(5-methyl-1,2-oxazol-3-yl)diazenyl]-N-phenylbutanamide is sourced from PubChem (CID 101424594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).