C28H30Cl2FN3O — CID 10142464
1-[4-(cyclopentylamino)-2-[4-(3-fluorophenyl)phenyl]butyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 10142464) has the molecular formula C28H30Cl2FN3O and a molecular weight of 514.47 g/mol. Its IUPAC name is 1-[4-(cyclopentylamino)-2-[4-(3-fluorophenyl)phenyl]butyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[4-(cyclopentylamino)-2-[4-(3-fluorophenyl)phenyl]butyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 10142464 |
| Molecular Formula | C28H30Cl2FN3O |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 1-[4-(cyclopentylamino)-2-[4-(3-fluorophenyl)phenyl]butyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(NCC(CCNC1CCCC1)c1ccc(-c2cccc(F)c2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H30Cl2FN3O/c29-23-15-24(30)17-27(16-23)34-28(35)33-18-22(12-13-32-26-6-1-2-7-26)20-10-8-19(9-11-20)21-4-3-5-25(31)14-21/h3-5,8-11,14-17,22,26,32H,1-2,6-7,12-13,18H2,(H2,33,34,35) |
| InChIKey | FWQVEPLQUPRTLH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |