C14H10I2O4S2 — CID 101424679
4,9-diiodo-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene (PubChem CID 101424679) has the molecular formula C14H10I2O4S2 and a molecular weight of 560.17 g/mol. Its IUPAC name is 4,9-diiodo-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene.
| Compound Name | 4,9-diiodo-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
|---|---|
| PubChem CID | 101424679 |
| Molecular Formula | C14H10I2O4S2 |
| Molecular Weight | 560.17 g/mol |
| Exact Mass | 559.81 |
| IUPAC Name | 4,9-diiodo-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
| SMILES | Ic1cc2c(s1)-c1sc(I)cc1C13OCCOC21OCCO3 |
| InChI | InChI=1S/C14H10I2O4S2/c15-9-5-7-11(21-9)12-8(6-10(16)22-12)14-13(7,17-1-2-18-14)19-3-4-20-14/h5-6H,1-4H2 |
| InChIKey | NHHUXKZMYAVOOC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|